C15H13N3O3S — CID 137028519
3-[(5-methyl-2-oxo-1H-indol-3-ylidene)amino]benzenesulfonamide (PubChem CID 137028519) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is 3-[(5-methyl-2-oxo-1H-indol-3-ylidene)amino]benzenesulfonamide.
| Compound Name | 3-[(5-methyl-2-oxo-1H-indol-3-ylidene)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 137028519 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 3-[(5-methyl-2-oxo-1H-indol-3-ylidene)amino]benzenesulfonamide |
| SMILES | Cc1ccc2c(c1)/C(=N/c1cccc(S(N)(=O)=O)c1)C(=O)N2 |
| InChI | InChI=1S/C15H13N3O3S/c1-9-5-6-13-12(7-9)14(15(19)18-13)17-10-3-2-4-11(8-10)22(16,20)21/h2-8H,1H3,(H2,16,20,21)(H,17,18,19) |
| InChIKey | MGEFUUBEKQFGOS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|