C21H15N5O6S — CID 137226401
4-[(5-nitro-2-oxo-1H-indol-3-ylidene)amino]-N-(4-sulfamoylphenyl)benzamide (PubChem CID 137226401) has the molecular formula C21H15N5O6S and a molecular weight of 465.45 g/mol. Its IUPAC name is 4-[(5-nitro-2-oxo-1H-indol-3-ylidene)amino]-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 4-[(5-nitro-2-oxo-1H-indol-3-ylidene)amino]-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 137226401 |
| Molecular Formula | C21H15N5O6S |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 4-[(5-nitro-2-oxo-1H-indol-3-ylidene)amino]-N-(4-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2ccc(/N=C3\C(=O)Nc4ccc([N+](=O)[O-])cc43)cc2)cc1 |
| InChI | InChI=1S/C21H15N5O6S/c22-33(31,32)16-8-5-14(6-9-16)24-20(27)12-1-3-13(4-2-12)23-19-17-11-15(26(29)30)7-10-18(17)25-21(19)28/h1-11H,(H,24,27)(H2,22,31,32)(H,23,25,28) |
| InChIKey | YIBCANYWXNDXHL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 173.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|