C16H17NO5 — CID 1355632
(2-aminophenyl) 3,4,5-trimethoxybenzoate (PubChem CID 1355632) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is (2-aminophenyl) 3,4,5-trimethoxybenzoate.
| Compound Name | (2-aminophenyl) 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 1355632 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (2-aminophenyl) 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccccc2N)cc(OC)c1OC |
| InChI | InChI=1S/C16H17NO5/c1-19-13-8-10(9-14(20-2)15(13)21-3)16(18)22-12-7-5-4-6-11(12)17/h4-9H,17H2,1-3H3 |
| InChIKey | QCXXLAKGIOGQAN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|