C16H13NO3 — CID 135566391
4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)benzene-1,3-diol (PubChem CID 135566391) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is 4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)benzene-1,3-diol.
| Compound Name | 4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 135566391 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-(5-methyl-4-phenyl-1,2-oxazol-3-yl)benzene-1,3-diol |
| SMILES | Cc1onc(-c2ccc(O)cc2O)c1-c1ccccc1 |
| InChI | InChI=1S/C16H13NO3/c1-10-15(11-5-3-2-4-6-11)16(17-20-10)13-8-7-12(18)9-14(13)19/h2-9,18-19H,1H3 |
| InChIKey | KARJVPOSIFHKDG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |