C25H28N4O2S — CID 135572998
ethyl 2-[(2,5-dimethylphenyl)methylsulfanyl]-5-methyl-7-(4-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135572998) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is ethyl 2-[(2,5-dimethylphenyl)methylsulfanyl]-5-methyl-7-(4-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-[(2,5-dimethylphenyl)methylsulfanyl]-5-methyl-7-(4-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135572998 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | ethyl 2-[(2,5-dimethylphenyl)methylsulfanyl]-5-methyl-7-(4-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(SCc3cc(C)ccc3C)nn2C1c1ccc(C)cc1 |
| InChI | InChI=1S/C25H28N4O2S/c1-6-31-23(30)21-18(5)26-24-27-25(32-14-20-13-16(3)7-10-17(20)4)28-29(24)22(21)19-11-8-15(2)9-12-19/h7-13,22H,6,14H2,1-5H3,(H,26,27,28) |
| InChIKey | HEXFROGRMIAAHH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |