C19H14N2O3S — CID 135575309
3-(2-ethylphenyl)-4-hydroxy-5-(2-oxoindol-3-yl)-1,3-thiazol-2-one (PubChem CID 135575309) has the molecular formula C19H14N2O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is 3-(2-ethylphenyl)-4-hydroxy-5-(2-oxoindol-3-yl)-1,3-thiazol-2-one.
| Compound Name | 3-(2-ethylphenyl)-4-hydroxy-5-(2-oxoindol-3-yl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 135575309 |
| Molecular Formula | C19H14N2O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 3-(2-ethylphenyl)-4-hydroxy-5-(2-oxoindol-3-yl)-1,3-thiazol-2-one |
| SMILES | CCc1ccccc1-n1c(O)c(C2=c3ccccc3=NC2=O)sc1=O |
| InChI | InChI=1S/C19H14N2O3S/c1-2-11-7-3-6-10-14(11)21-18(23)16(25-19(21)24)15-12-8-4-5-9-13(12)20-17(15)22/h3-10,23H,2H2,1H3 |
| InChIKey | SEZHAMXANLSZNF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |