C28H26N6O4 — CID 135580842
N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[(2E)-2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]-4-nitrobenzamide (PubChem CID 135580842) has the molecular formula C28H26N6O4 and a molecular weight of 510.55 g/mol. Its IUPAC name is N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[(2E)-2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]-4-nitrobenzamide.
| Compound Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[(2E)-2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 135580842 |
| Molecular Formula | C28H26N6O4 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[(2E)-2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]-4-nitrobenzamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=N/NC(=O)/C(=C/c1ccc(N(C)C)cc1)NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H26N6O4/c1-18-24(23-6-4-5-7-25(23)30-18)17-29-32-28(36)26(16-19-8-12-21(13-9-19)33(2)3)31-27(35)20-10-14-22(15-11-20)34(37)38/h4-17,30H,1-3H3,(H,31,35)(H,32,36)/b26-16-,29-17+ |
| InChIKey | WCLDWGTYQOBDPW-ROSBBMSDSA-N |
| XLogP | 4.37 |
| TPSA | 132.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|