C26H23Br2N5O6 — CID 136815888
N-[(E)-3-[(2Z)-2-[(3,5-dibromo-2,4-dihydroxy-6-methylphenyl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]-4-nitrobenzamide (PubChem CID 136815888) has the molecular formula C26H23Br2N5O6 and a molecular weight of 661.31 g/mol. Its IUPAC name is N-[(E)-3-[(2Z)-2-[(3,5-dibromo-2,4-dihydroxy-6-methylphenyl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]-4-nitrobenzamide.
| Compound Name | N-[(E)-3-[(2Z)-2-[(3,5-dibromo-2,4-dihydroxy-6-methylphenyl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 136815888 |
| Molecular Formula | C26H23Br2N5O6 |
| Molecular Weight | 661.31 g/mol |
| Exact Mass | 659.00 |
| IUPAC Name | N-[(E)-3-[(2Z)-2-[(3,5-dibromo-2,4-dihydroxy-6-methylphenyl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]-4-nitrobenzamide |
| SMILES | Cc1c(Br)c(O)c(Br)c(O)c1/C=N\NC(=O)/C(=C\c1ccc(N(C)C)cc1)NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H23Br2N5O6/c1-14-19(23(34)22(28)24(35)21(14)27)13-29-31-26(37)20(12-15-4-8-17(9-5-15)32(2)3)30-25(36)16-6-10-18(11-7-16)33(38)39/h4-13,34-35H,1-3H3,(H,30,36)(H,31,37)/b20-12+,29-13- |
| InChIKey | QRRNAMNQUYLGKG-LWXKNMAKSA-N |
| XLogP | 4.83 |
| TPSA | 157.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|