C14H15NO8 — CID 135580984
2-acetyl-5,5-dihydroxy-3-(4-methoxyphenyl)-4-nitropent-4-enoic acid (PubChem CID 135580984) has the molecular formula C14H15NO8 and a molecular weight of 325.27 g/mol. Its IUPAC name is 2-acetyl-5,5-dihydroxy-3-(4-methoxyphenyl)-4-nitropent-4-enoic acid.
| Compound Name | 2-acetyl-5,5-dihydroxy-3-(4-methoxyphenyl)-4-nitropent-4-enoic acid |
|---|---|
| PubChem CID | 135580984 |
| Molecular Formula | C14H15NO8 |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-acetyl-5,5-dihydroxy-3-(4-methoxyphenyl)-4-nitropent-4-enoic acid |
| SMILES | COc1ccc(C(C(=C(O)O)[N+](=O)[O-])C(C(C)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C14H15NO8/c1-7(16)10(13(17)18)11(12(14(19)20)15(21)22)8-3-5-9(23-2)6-4-8/h3-6,10-11,19-20H,1-2H3,(H,17,18) |
| InChIKey | RGIOJRHIHSBKER-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 147.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|