C14H12F3NO7 — CID 135580993
2-acetyl-5,5-dihydroxy-4-nitro-3-[3-(trifluoromethyl)phenyl]pent-4-enoic acid (PubChem CID 135580993) has the molecular formula C14H12F3NO7 and a molecular weight of 363.24 g/mol. Its IUPAC name is 2-acetyl-5,5-dihydroxy-4-nitro-3-[3-(trifluoromethyl)phenyl]pent-4-enoic acid.
| Compound Name | 2-acetyl-5,5-dihydroxy-4-nitro-3-[3-(trifluoromethyl)phenyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 135580993 |
| Molecular Formula | C14H12F3NO7 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 2-acetyl-5,5-dihydroxy-4-nitro-3-[3-(trifluoromethyl)phenyl]pent-4-enoic acid |
| SMILES | CC(=O)C(C(=O)O)C(C(=C(O)O)[N+](=O)[O-])c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F3NO7/c1-6(19)9(12(20)21)10(11(13(22)23)18(24)25)7-3-2-4-8(5-7)14(15,16)17/h2-5,9-10,22-23H,1H3,(H,20,21) |
| InChIKey | QVBAZDFOYVTOEI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|