C20H37N3O4 — CID 135581525
(2S)-N-[(2S)-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-2-pentylbutanediamide (PubChem CID 135581525) has the molecular formula C20H37N3O4 and a molecular weight of 383.53 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-2-pentylbutanediamide.
| Compound Name | (2S)-N-[(2S)-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-2-pentylbutanediamide |
|---|---|
| PubChem CID | 135581525 |
| Molecular Formula | C20H37N3O4 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | (2S)-N-[(2S)-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-2-pentylbutanediamide |
| SMILES | CCCCC[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1CO |
| InChI | InChI=1S/C20H37N3O4/c1-4-5-6-8-15(12-18(21)25)19(26)22-17(11-14(2)3)20(27)23-10-7-9-16(23)13-24/h14-17,24H,4-13H2,1-3H3,(H2,21,25)(H,22,26)/t15-,16-,17-/m0/s1 |
| InChIKey | DWICPGLRCPUIIC-ULQDDVLXSA-N |
| XLogP | 1.57 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|