C20H37N3O5 — CID 10111557
(2R)-N'-hydroxy-N-[(2S)-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-2-pentylbutanediamide (PubChem CID 10111557) has the molecular formula C20H37N3O5 and a molecular weight of 399.53 g/mol. Its IUPAC name is (2R)-N'-hydroxy-N-[(2S)-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-2-pentylbutanediamide.
| Compound Name | (2R)-N'-hydroxy-N-[(2S)-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-2-pentylbutanediamide |
|---|---|
| PubChem CID | 10111557 |
| Molecular Formula | C20H37N3O5 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | (2R)-N'-hydroxy-N-[(2S)-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-2-pentylbutanediamide |
| SMILES | CCCCC[C@H](CC(=O)NO)C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1CO |
| InChI | InChI=1S/C20H37N3O5/c1-4-5-6-8-15(12-18(25)22-28)19(26)21-17(11-14(2)3)20(27)23-10-7-9-16(23)13-24/h14-17,24,28H,4-13H2,1-3H3,(H,21,26)(H,22,25)/t15-,16+,17+/m1/s1 |
| InChIKey | BPSDRPHIGGBGBO-IKGGRYGDSA-N |
| XLogP | 1.59 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|