C19H34N4O5 — CID 139514955
N-[1-[2-(hydroxymethyl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-N'-nitroso-2-pentylbutanediamide (PubChem CID 139514955) has the molecular formula C19H34N4O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is N-[1-[2-(hydroxymethyl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-N'-nitroso-2-pentylbutanediamide.
| Compound Name | N-[1-[2-(hydroxymethyl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-N'-nitroso-2-pentylbutanediamide |
|---|---|
| PubChem CID | 139514955 |
| Molecular Formula | C19H34N4O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | N-[1-[2-(hydroxymethyl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-N'-nitroso-2-pentylbutanediamide |
| SMILES | CCCCCC(CC(=O)NN=O)C(=O)NC(C(=O)N1CCCC1CO)C(C)C |
| InChI | InChI=1S/C19H34N4O5/c1-4-5-6-8-14(11-16(25)21-22-28)18(26)20-17(13(2)3)19(27)23-10-7-9-15(23)12-24/h13-15,17,24H,4-12H2,1-3H3,(H,20,26)(H,21,25,28) |
| InChIKey | NNYRXVZHKHFPJO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|