C19H33N3O6 — CID 67742382
(2S)-1-[(2S)-2-[2-(2-amino-1-hydroxy-2-oxoethyl)heptanoylamino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 67742382) has the molecular formula C19H33N3O6 and a molecular weight of 399.49 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[2-(2-amino-1-hydroxy-2-oxoethyl)heptanoylamino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[2-(2-amino-1-hydroxy-2-oxoethyl)heptanoylamino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67742382 |
| Molecular Formula | C19H33N3O6 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | (2S)-1-[(2S)-2-[2-(2-amino-1-hydroxy-2-oxoethyl)heptanoylamino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCCCC(C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)O)C(C)C)C(O)C(N)=O |
| InChI | InChI=1S/C19H33N3O6/c1-4-5-6-8-12(15(23)16(20)24)17(25)21-14(11(2)3)18(26)22-10-7-9-13(22)19(27)28/h11-15,23H,4-10H2,1-3H3,(H2,20,24)(H,21,25)(H,27,28)/t12?,13-,14-,15?/m0/s1 |
| InChIKey | CMFXSULTXHPHDQ-GQKFXUNGSA-N |
| XLogP | 0.25 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|