C23H20BrN3O2 — CID 135581796
3-benzyl-N-[(4-bromophenyl)methyl]-6-hydroxy-N-methyl-2H-indazole-5-carboxamide (PubChem CID 135581796) has the molecular formula C23H20BrN3O2 and a molecular weight of 450.34 g/mol. Its IUPAC name is 3-benzyl-N-[(4-bromophenyl)methyl]-6-hydroxy-N-methyl-2H-indazole-5-carboxamide.
| Compound Name | 3-benzyl-N-[(4-bromophenyl)methyl]-6-hydroxy-N-methyl-2H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 135581796 |
| Molecular Formula | C23H20BrN3O2 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 3-benzyl-N-[(4-bromophenyl)methyl]-6-hydroxy-N-methyl-2H-indazole-5-carboxamide |
| SMILES | CN(Cc1ccc(Br)cc1)C(=O)c1cc2c(Cc3ccccc3)[nH]nc2cc1O |
| InChI | InChI=1S/C23H20BrN3O2/c1-27(14-16-7-9-17(24)10-8-16)23(29)19-12-18-20(11-15-5-3-2-4-6-15)25-26-21(18)13-22(19)28/h2-10,12-13,28H,11,14H2,1H3,(H,25,26) |
| InChIKey | WYONIVZQGXVCLM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |