C17H22N4O3S — CID 135582456
ethyl 2,4-dimethyl-5-[(E)-C-methyl-N-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]carbonimidoyl]-1H-pyrrole-3-carboxylate (PubChem CID 135582456) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-5-[(E)-C-methyl-N-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]carbonimidoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-5-[(E)-C-methyl-N-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]carbonimidoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 135582456 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | ethyl 2,4-dimethyl-5-[(E)-C-methyl-N-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]carbonimidoyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(/C(C)=N/NC(=O)Cc2csc(C)n2)c1C |
| InChI | InChI=1S/C17H22N4O3S/c1-6-24-17(23)15-9(2)16(18-10(15)3)11(4)20-21-14(22)7-13-8-25-12(5)19-13/h8,18H,6-7H2,1-5H3,(H,21,22)/b20-11+ |
| InChIKey | AOPHKQWNZZRYOU-RGVLZGJSSA-N |
| XLogP | 2.66 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|