C16H23N3O5S — CID 135817834
ethyl 5-[(E)-N-[[(3R)-1,1-dioxothiolane-3-carbonyl]amino]-C-methylcarbonimidoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 135817834) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is ethyl 5-[(E)-N-[[(3R)-1,1-dioxothiolane-3-carbonyl]amino]-C-methylcarbonimidoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[(E)-N-[[(3R)-1,1-dioxothiolane-3-carbonyl]amino]-C-methylcarbonimidoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 135817834 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | ethyl 5-[(E)-N-[[(3R)-1,1-dioxothiolane-3-carbonyl]amino]-C-methylcarbonimidoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(/C(C)=N/NC(=O)[C@H]2CCS(=O)(=O)C2)c1C |
| InChI | InChI=1S/C16H23N3O5S/c1-5-24-16(21)13-9(2)14(17-10(13)3)11(4)18-19-15(20)12-6-7-25(22,23)8-12/h12,17H,5-8H2,1-4H3,(H,19,20)/b18-11+/t12-/m0/s1 |
| InChIKey | SFMBSLDWMNUWAC-HWQJWEFDSA-N |
| XLogP | 1.08 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|