C31H37F2NO9S — CID 135582734
[4-[(2S,5S)-2-[(4-fluoroanilino)methyl]-5-(4-fluorophenyl)-5-hydroxypentyl]phenyl] [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methanesulfonate (PubChem CID 135582734) has the molecular formula C31H37F2NO9S and a molecular weight of 637.70 g/mol. Its IUPAC name is [4-[(2S,5S)-2-[(4-fluoroanilino)methyl]-5-(4-fluorophenyl)-5-hydroxypentyl]phenyl] [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methanesulfonate.
| Compound Name | [4-[(2S,5S)-2-[(4-fluoroanilino)methyl]-5-(4-fluorophenyl)-5-hydroxypentyl]phenyl] [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methanesulfonate |
|---|---|
| PubChem CID | 135582734 |
| Molecular Formula | C31H37F2NO9S |
| Molecular Weight | 637.70 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | [4-[(2S,5S)-2-[(4-fluoroanilino)methyl]-5-(4-fluorophenyl)-5-hydroxypentyl]phenyl] [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methanesulfonate |
| SMILES | CO[C@H]1O[C@H](CS(=O)(=O)Oc2ccc(C[C@H](CC[C@H](O)c3ccc(F)cc3)CNc3ccc(F)cc3)cc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C31H37F2NO9S/c1-41-31-30(38)29(37)28(36)27(42-31)18-44(39,40)43-25-13-2-19(3-14-25)16-20(17-34-24-11-9-23(33)10-12-24)4-15-26(35)21-5-7-22(32)8-6-21/h2-3,5-14,20,26-31,34-38H,4,15-18H2,1H3/t20-,26-,27+,28+,29-,30+,31-/m0/s1 |
| InChIKey | BOEZALUIIRBRJK-SEBSRTTPSA-N |
| XLogP | 2.91 |
| TPSA | 154.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.70 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|