C31H35F2NO9S — CID 11354161
[4-[(2S,3S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-yl]phenyl] [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methanesulfonate (PubChem CID 11354161) has the molecular formula C31H35F2NO9S and a molecular weight of 635.68 g/mol. Its IUPAC name is [4-[(2S,3S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-yl]phenyl] [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methanesulfonate.
| Compound Name | [4-[(2S,3S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-yl]phenyl] [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methanesulfonate |
|---|---|
| PubChem CID | 11354161 |
| Molecular Formula | C31H35F2NO9S |
| Molecular Weight | 635.68 g/mol |
| Exact Mass | 635.20 |
| IUPAC Name | [4-[(2S,3S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-yl]phenyl] [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methanesulfonate |
| SMILES | CO[C@H]1O[C@H](CS(=O)(=O)Oc2ccc([C@@H]3[C@@H](CC[C@H](O)c4ccc(F)cc4)CN3c3ccc(F)cc3)cc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C31H35F2NO9S/c1-41-31-30(38)29(37)28(36)26(42-31)17-44(39,40)43-24-13-4-19(5-14-24)27-20(16-34(27)23-11-9-22(33)10-12-23)6-15-25(35)18-2-7-21(32)8-3-18/h2-5,7-14,20,25-31,35-38H,6,15-17H2,1H3/t20-,25-,26+,27+,28+,29-,30+,31-/m0/s1 |
| InChIKey | CEJCMOAIRJHBDE-ZNFOMRBHSA-N |
| XLogP | 2.82 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.68 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|