C22H21FN2O3 — CID 135583456
[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 135583456) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 135583456 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | C[C@@H](OC(=O)C1(c2ccc(F)cc2)CCCC1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C22H21FN2O3/c1-14(19-24-18-7-3-2-6-17(18)20(26)25-19)28-21(27)22(12-4-5-13-22)15-8-10-16(23)11-9-15/h2-3,6-11,14H,4-5,12-13H2,1H3,(H,24,25,26)/t14-/m1/s1 |
| InChIKey | JHFBECLIHVNJHN-CQSZACIVSA-N |
| XLogP | 4.18 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |