C19H19N5O6S — CID 135587513
prop-2-enyl 2-(2-methoxy-2-oxoethyl)sulfanyl-5-methyl-7-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135587513) has the molecular formula C19H19N5O6S and a molecular weight of 445.46 g/mol. Its IUPAC name is prop-2-enyl 2-(2-methoxy-2-oxoethyl)sulfanyl-5-methyl-7-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl 2-(2-methoxy-2-oxoethyl)sulfanyl-5-methyl-7-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135587513 |
| Molecular Formula | C19H19N5O6S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | prop-2-enyl 2-(2-methoxy-2-oxoethyl)sulfanyl-5-methyl-7-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)Nc2nc(SCC(=O)OC)nn2C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19N5O6S/c1-4-9-30-17(26)15-11(2)20-18-21-19(31-10-14(25)29-3)22-23(18)16(15)12-5-7-13(8-6-12)24(27)28/h4-8,16H,1,9-10H2,2-3H3,(H,20,21,22) |
| InChIKey | GJDKXIJEUZKTKX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 138.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|