C23H26N6O2 — CID 135591394
1'-benzylspiro[4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaene-13,4'-piperidine]-15-amine (PubChem CID 135591394) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 1'-benzylspiro[4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaene-13,4'-piperidine]-15-amine.
| Compound Name | 1'-benzylspiro[4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaene-13,4'-piperidine]-15-amine |
|---|---|
| PubChem CID | 135591394 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 1'-benzylspiro[4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaene-13,4'-piperidine]-15-amine |
| SMILES | NC1=NC2(CCN(Cc3ccccc3)CC2)n2c(nc3cc4c(cc32)OCCCO4)N1 |
| InChI | InChI=1S/C23H26N6O2/c24-21-26-22-25-17-13-19-20(31-12-4-11-30-19)14-18(17)29(22)23(27-21)7-9-28(10-8-23)15-16-5-2-1-3-6-16/h1-3,5-6,13-14H,4,7-12,15H2,(H3,24,25,26,27) |
| InChIKey | YIEDHLSORSDQBA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |