C18H17N5O3 — CID 135881917
4-[(13R)-15-amino-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-13-yl]phenol (PubChem CID 135881917) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is 4-[(13R)-15-amino-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-13-yl]phenol.
| Compound Name | 4-[(13R)-15-amino-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-13-yl]phenol |
|---|---|
| PubChem CID | 135881917 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 4-[(13R)-15-amino-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-13-yl]phenol |
| SMILES | NC1=N[C@@H](c2ccc(O)cc2)n2c(nc3cc4c(cc32)OCCCO4)N1 |
| InChI | InChI=1S/C18H17N5O3/c19-17-21-16(10-2-4-11(24)5-3-10)23-13-9-15-14(25-6-1-7-26-15)8-12(13)20-18(23)22-17/h2-5,8-9,16,24H,1,6-7H2,(H3,19,20,21,22)/t16-/m1/s1 |
| InChIKey | KTOKFDYYCYTQLL-MRXNPFEDSA-N |
| XLogP | 2.19 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |