C16H28O3 — CID 135591838
(2S)-2-[(4S,5S,6R)-2,2,5-trimethyl-6-[(3S)-3-methylpent-4-enyl]-1,3-dioxan-4-yl]propanal (PubChem CID 135591838) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (2S)-2-[(4S,5S,6R)-2,2,5-trimethyl-6-[(3S)-3-methylpent-4-enyl]-1,3-dioxan-4-yl]propanal.
| Compound Name | (2S)-2-[(4S,5S,6R)-2,2,5-trimethyl-6-[(3S)-3-methylpent-4-enyl]-1,3-dioxan-4-yl]propanal |
|---|---|
| PubChem CID | 135591838 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (2S)-2-[(4S,5S,6R)-2,2,5-trimethyl-6-[(3S)-3-methylpent-4-enyl]-1,3-dioxan-4-yl]propanal |
| SMILES | C=C[C@@H](C)CC[C@H]1OC(C)(C)O[C@H]([C@H](C)C=O)[C@H]1C |
| InChI | InChI=1S/C16H28O3/c1-7-11(2)8-9-14-13(4)15(12(3)10-17)19-16(5,6)18-14/h7,10-15H,1,8-9H2,2-6H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | HXURTRXRGRTNFZ-UXXRCYHCSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|