C15H14N3O5S2- — CID 135593815
2-[(2E,5S)-2-[[(2S)-2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]imino]-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 135593815) has the molecular formula C15H14N3O5S2- and a molecular weight of 380.43 g/mol. Its IUPAC name is 2-[(2E,5S)-2-[[(2S)-2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]imino]-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2E,5S)-2-[[(2S)-2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]imino]-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135593815 |
| Molecular Formula | C15H14N3O5S2- |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 2-[(2E,5S)-2-[[(2S)-2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]imino]-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | COc1ccc([C@@H]2SCC(=O)N2/N=C2\NC(=O)[C@H](CC(=O)[O-])S2)cc1 |
| InChI | InChI=1S/C15H15N3O5S2/c1-23-9-4-2-8(3-5-9)14-18(11(19)7-24-14)17-15-16-13(22)10(25-15)6-12(20)21/h2-5,10,14H,6-7H2,1H3,(H,20,21)(H,16,17,22)/p-1/t10-,14-/m0/s1 |
| InChIKey | BZXFDCQZGGBAJN-HZMBPMFUSA-M |
| XLogP | -0.09 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|