C20H16N2O6S2 — CID 35581367
[4-[(2R)-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl] 2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 35581367) has the molecular formula C20H16N2O6S2 and a molecular weight of 444.49 g/mol. Its IUPAC name is [4-[(2R)-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl] 2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | [4-[(2R)-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl] 2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 35581367 |
| Molecular Formula | C20H16N2O6S2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | [4-[(2R)-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl] 2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | O=C(C[C@H]1SC(=O)NC1=O)Oc1ccc([C@H]2SCC(=O)N2c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C20H16N2O6S2/c23-13-5-3-12(4-6-13)22-16(24)10-29-19(22)11-1-7-14(8-2-11)28-17(25)9-15-18(26)21-20(27)30-15/h1-8,15,19,23H,9-10H2,(H,21,26,27)/t15-,19-/m1/s1 |
| InChIKey | VGSWBGLPINHSFY-DNVCBOLYSA-N |
| XLogP | 2.82 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|