C22H20N2O6S2 — CID 43842437
[2-methoxy-4-[3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate (PubChem CID 43842437) has the molecular formula C22H20N2O6S2 and a molecular weight of 472.54 g/mol. Its IUPAC name is [2-methoxy-4-[3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate.
| Compound Name | [2-methoxy-4-[3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate |
|---|---|
| PubChem CID | 43842437 |
| Molecular Formula | C22H20N2O6S2 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | [2-methoxy-4-[3-(4-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate |
| SMILES | COc1cc(C2SCC(=O)N2c2ccc(C)cc2)ccc1OC(=O)CC1SC(=O)NC1=O |
| InChI | InChI=1S/C22H20N2O6S2/c1-12-3-6-14(7-4-12)24-18(25)11-31-21(24)13-5-8-15(16(9-13)29-2)30-19(26)10-17-20(27)23-22(28)32-17/h3-9,17,21H,10-11H2,1-2H3,(H,23,27,28) |
| InChIKey | QYMUNIXFJOAJAL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|