C26H27N3O3 — CID 135594009
(E)-1-[6,6-bis(3-methoxyphenyl)-1,7-dihydroindazol-3-yl]-1-cyclopropyl-N-methoxymethanimine (PubChem CID 135594009) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is (E)-1-[6,6-bis(3-methoxyphenyl)-1,7-dihydroindazol-3-yl]-1-cyclopropyl-N-methoxymethanimine.
| Compound Name | (E)-1-[6,6-bis(3-methoxyphenyl)-1,7-dihydroindazol-3-yl]-1-cyclopropyl-N-methoxymethanimine |
|---|---|
| PubChem CID | 135594009 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (E)-1-[6,6-bis(3-methoxyphenyl)-1,7-dihydroindazol-3-yl]-1-cyclopropyl-N-methoxymethanimine |
| SMILES | CO/N=C(/c1n[nH]c2c1C=CC(c1cccc(OC)c1)(c1cccc(OC)c1)C2)C1CC1 |
| InChI | InChI=1S/C26H27N3O3/c1-30-20-8-4-6-18(14-20)26(19-7-5-9-21(15-19)31-2)13-12-22-23(16-26)27-28-25(22)24(29-32-3)17-10-11-17/h4-9,12-15,17H,10-11,16H2,1-3H3,(H,27,28)/b29-24+ |
| InChIKey | KUKKDQKZGYLSEL-RMLRFSFXSA-N |
| XLogP | 4.74 |
| TPSA | 68.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|