C25H25N3O2 — CID 135594007
(NE)-N-[cyclobutyl-[6-(3-methoxyphenyl)-6-phenyl-1,7-dihydroindazol-3-yl]methylidene]hydroxylamine (PubChem CID 135594007) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is (NE)-N-[cyclobutyl-[6-(3-methoxyphenyl)-6-phenyl-1,7-dihydroindazol-3-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[cyclobutyl-[6-(3-methoxyphenyl)-6-phenyl-1,7-dihydroindazol-3-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135594007 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (NE)-N-[cyclobutyl-[6-(3-methoxyphenyl)-6-phenyl-1,7-dihydroindazol-3-yl]methylidene]hydroxylamine |
| SMILES | COc1cccc(C2(c3ccccc3)C=Cc3c(/C(=N/O)C4CCC4)n[nH]c3C2)c1 |
| InChI | InChI=1S/C25H25N3O2/c1-30-20-12-6-11-19(15-20)25(18-9-3-2-4-10-18)14-13-21-22(16-25)26-27-24(21)23(28-29)17-7-5-8-17/h2-4,6,9-15,17,29H,5,7-8,16H2,1H3,(H,26,27)/b28-23+ |
| InChIKey | AOVOZEYCYAQIMV-WEMUOSSPSA-N |
| XLogP | 4.95 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|