C18H24O3 — CID 118291934
(1S,4aS,5S,8aS)-5-hydroxy-4a-(3-methoxyphenyl)-1-methyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one (PubChem CID 118291934) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (1S,4aS,5S,8aS)-5-hydroxy-4a-(3-methoxyphenyl)-1-methyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one.
| Compound Name | (1S,4aS,5S,8aS)-5-hydroxy-4a-(3-methoxyphenyl)-1-methyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 118291934 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (1S,4aS,5S,8aS)-5-hydroxy-4a-(3-methoxyphenyl)-1-methyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
| SMILES | COc1cccc([C@]23CCC(=O)[C@@H](C)[C@@H]2CCC[C@@H]3O)c1 |
| InChI | InChI=1S/C18H24O3/c1-12-15-7-4-8-17(20)18(15,10-9-16(12)19)13-5-3-6-14(11-13)21-2/h3,5-6,11-12,15,17,20H,4,7-10H2,1-2H3/t12-,15-,17-,18+/m0/s1 |
| InChIKey | QSQZMIRGOITIDW-OYYDLILQSA-N |
| XLogP | 3.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |