C25H24N2O — CID 135761900
(E)-1-cyclopropyl-1-(5,5-diphenyl-2,4-dihydroisoindol-1-yl)-N-methoxymethanimine (PubChem CID 135761900) has the molecular formula C25H24N2O and a molecular weight of 368.48 g/mol. Its IUPAC name is (E)-1-cyclopropyl-1-(5,5-diphenyl-2,4-dihydroisoindol-1-yl)-N-methoxymethanimine.
| Compound Name | (E)-1-cyclopropyl-1-(5,5-diphenyl-2,4-dihydroisoindol-1-yl)-N-methoxymethanimine |
|---|---|
| PubChem CID | 135761900 |
| Molecular Formula | C25H24N2O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (E)-1-cyclopropyl-1-(5,5-diphenyl-2,4-dihydroisoindol-1-yl)-N-methoxymethanimine |
| SMILES | CO/N=C(/c1[nH]cc2c1C=CC(c1ccccc1)(c1ccccc1)C2)C1CC1 |
| InChI | InChI=1S/C25H24N2O/c1-28-27-23(18-12-13-18)24-22-14-15-25(16-19(22)17-26-24,20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-11,14-15,17-18,26H,12-13,16H2,1H3/b27-23+ |
| InChIKey | LONQFYKVNRAXSA-SLEBQGDGSA-N |
| XLogP | 5.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|