About methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate
methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate (PubChem CID 70205985) has the molecular formula C30H24O3
and a molecular weight of 432.52 g/mol. Its IUPAC name is methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate |
| PubChem CID | 70205985 |
| Molecular Formula | C30H24O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2O)ccc2c1C=CC(c1ccccc1)(c1ccccc1)C2 |
| InChI | InChI=1S/C30H24O3/c1-33-29(32)28-24-18-19-30(22-10-4-2-5-11-22,23-12-6-3-7-13-23)20-21(24)16-17-26(28)25-14-8-9-15-27(25)31/h2-19,31H,20H2,1H3 |
| InChIKey | KJPLFFMIAXJTQW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate?
The IUPAC name of methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate (CID 70205985) is methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate.
What is the SMILES notation for methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate?
The canonical SMILES for methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate is COC(=O)c1c(-c2ccccc2O)ccc2c1C=CC(c1ccccc1)(c1ccccc1)C2.
What is the InChIKey of methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate?
The InChIKey is KJPLFFMIAXJTQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24O3/c1-33-29(32)28-24-18-19-30(22-10-4-2-5-11-22,23-12-6-3-7-13-23)20-21(24)16-17-26(28)25-14-8-9-15-27(25)31/h2-19,31H,20H2,1H3.
What are the key properties of methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate?
methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate has a molecular weight of 432.52 g/mol, XLogP of 6.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate is sourced from PubChem (CID 70205985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).