C30H24O3 — CID 70205985
methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate (PubChem CID 70205985) has the molecular formula C30H24O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate.
| Compound Name | methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 70205985 |
| Molecular Formula | C30H24O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | methyl 2-(2-hydroxyphenyl)-6,6-diphenyl-5H-naphthalene-1-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2O)ccc2c1C=CC(c1ccccc1)(c1ccccc1)C2 |
| InChI | InChI=1S/C30H24O3/c1-33-29(32)28-24-18-19-30(22-10-4-2-5-11-22,23-12-6-3-7-13-23)20-21(24)16-17-26(28)25-14-8-9-15-27(25)31/h2-19,31H,20H2,1H3 |
| InChIKey | KJPLFFMIAXJTQW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |