C26H26N2O4 — CID 90687634
cyclopropyl-[6-phenyl-6-(2,3,4-trimethoxyphenyl)-7H-indazol-1-yl]methanone (PubChem CID 90687634) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is cyclopropyl-[6-phenyl-6-(2,3,4-trimethoxyphenyl)-7H-indazol-1-yl]methanone.
| Compound Name | cyclopropyl-[6-phenyl-6-(2,3,4-trimethoxyphenyl)-7H-indazol-1-yl]methanone |
|---|---|
| PubChem CID | 90687634 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | cyclopropyl-[6-phenyl-6-(2,3,4-trimethoxyphenyl)-7H-indazol-1-yl]methanone |
| SMILES | COc1ccc(C2(c3ccccc3)C=Cc3cnn(C(=O)C4CC4)c3C2)c(OC)c1OC |
| InChI | InChI=1S/C26H26N2O4/c1-30-22-12-11-20(23(31-2)24(22)32-3)26(19-7-5-4-6-8-19)14-13-18-16-27-28(21(18)15-26)25(29)17-9-10-17/h4-8,11-14,16-17H,9-10,15H2,1-3H3 |
| InChIKey | PPDKGYWQRYGZRC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |