C17H17NO5 — CID 141336383
3-hydroxy-2,6,7-trimethoxy-3-phenylisoindol-1-one (PubChem CID 141336383) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 3-hydroxy-2,6,7-trimethoxy-3-phenylisoindol-1-one.
| Compound Name | 3-hydroxy-2,6,7-trimethoxy-3-phenylisoindol-1-one |
|---|---|
| PubChem CID | 141336383 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 3-hydroxy-2,6,7-trimethoxy-3-phenylisoindol-1-one |
| SMILES | COc1ccc2c(c1OC)C(=O)N(OC)C2(O)c1ccccc1 |
| InChI | InChI=1S/C17H17NO5/c1-21-13-10-9-12-14(15(13)22-2)16(19)18(23-3)17(12,20)11-7-5-4-6-8-11/h4-10,20H,1-3H3 |
| InChIKey | UQJWKDUQAUSBRO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |