C24H22N2O — CID 135761843
(NE)-N-[cyclopropyl-(5,5-diphenyl-3,4-dihydroisoindol-1-yl)methylidene]hydroxylamine (PubChem CID 135761843) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is (NE)-N-[cyclopropyl-(5,5-diphenyl-3,4-dihydroisoindol-1-yl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[cyclopropyl-(5,5-diphenyl-3,4-dihydroisoindol-1-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135761843 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (NE)-N-[cyclopropyl-(5,5-diphenyl-3,4-dihydroisoindol-1-yl)methylidene]hydroxylamine |
| SMILES | O/N=C(/C1=NCC2=C1C=CC(c1ccccc1)(c1ccccc1)C2)C1CC1 |
| InChI | InChI=1S/C24H22N2O/c27-26-22(17-11-12-17)23-21-13-14-24(15-18(21)16-25-23,19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-10,13-14,17,27H,11-12,15-16H2/b26-22+ |
| InChIKey | FROACDBQBQMJLO-XTCLZLMSSA-N |
| XLogP | 4.92 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|