C21H23N7OS — CID 135597170
(Z)-4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxy-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)but-2-enenitrile (PubChem CID 135597170) has the molecular formula C21H23N7OS and a molecular weight of 421.53 g/mol. Its IUPAC name is (Z)-4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxy-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)but-2-enenitrile.
| Compound Name | (Z)-4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxy-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 135597170 |
| Molecular Formula | C21H23N7OS |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | (Z)-4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxy-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)but-2-enenitrile |
| SMILES | CCn1c(SC/C(O)=C(\C#N)c2nnc3n2CCCCC3)nnc1-c1ccccc1 |
| InChI | InChI=1S/C21H23N7OS/c1-2-27-19(15-9-5-3-6-10-15)24-26-21(27)30-14-17(29)16(13-22)20-25-23-18-11-7-4-8-12-28(18)20/h3,5-6,9-10,29H,2,4,7-8,11-12,14H2,1H3/b17-16- |
| InChIKey | KYBXXHBXVKEOGS-MSUUIHNZSA-N |
| XLogP | 3.87 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|