C16H21N5OS2 — CID 135769354
[(Z)-3-cyano-2-hydroxy-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enyl] pyrrolidine-1-carbodithioate (PubChem CID 135769354) has the molecular formula C16H21N5OS2 and a molecular weight of 363.51 g/mol. Its IUPAC name is [(Z)-3-cyano-2-hydroxy-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enyl] pyrrolidine-1-carbodithioate.
| Compound Name | [(Z)-3-cyano-2-hydroxy-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 135769354 |
| Molecular Formula | C16H21N5OS2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | [(Z)-3-cyano-2-hydroxy-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enyl] pyrrolidine-1-carbodithioate |
| SMILES | N#C/C(=C(/O)CSC(=S)N1CCCC1)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C16H21N5OS2/c17-10-12(13(22)11-24-16(23)20-7-4-5-8-20)15-19-18-14-6-2-1-3-9-21(14)15/h22H,1-9,11H2/b13-12- |
| InChIKey | GMJXZSMIIOWBEW-SEYXRHQNSA-N |
| XLogP | 2.91 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|