C19H24F3N5O2 — CID 6301161
(E)-3-[2-(azepan-1-yl)-2-oxoethoxy]-4,4,4-trifluoro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)but-2-enenitrile (PubChem CID 6301161) has the molecular formula C19H24F3N5O2 and a molecular weight of 411.43 g/mol. Its IUPAC name is (E)-3-[2-(azepan-1-yl)-2-oxoethoxy]-4,4,4-trifluoro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)but-2-enenitrile.
| Compound Name | (E)-3-[2-(azepan-1-yl)-2-oxoethoxy]-4,4,4-trifluoro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 6301161 |
| Molecular Formula | C19H24F3N5O2 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (E)-3-[2-(azepan-1-yl)-2-oxoethoxy]-4,4,4-trifluoro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)but-2-enenitrile |
| SMILES | N#C/C(=C(\OCC(=O)N1CCCCCC1)C(F)(F)F)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C19H24F3N5O2/c20-19(21,22)17(29-13-16(28)26-9-5-1-2-6-10-26)14(12-23)18-25-24-15-8-4-3-7-11-27(15)18/h1-11,13H2/b17-14+ |
| InChIKey | VUYKCZAVTZJENJ-SAPNQHFASA-N |
| XLogP | 3.22 |
| TPSA | 84.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|