C20H25ClFN2O2+ — CID 135598140
[(1R)-1-(2-chloro-6-fluorophenyl)-2-[(2-hydroxy-4-propoxyphenyl)methylideneamino]ethyl]-dimethylazanium (PubChem CID 135598140) has the molecular formula C20H25ClFN2O2+ and a molecular weight of 379.88 g/mol. Its IUPAC name is [(1R)-1-(2-chloro-6-fluorophenyl)-2-[(2-hydroxy-4-propoxyphenyl)methylideneamino]ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-(2-chloro-6-fluorophenyl)-2-[(2-hydroxy-4-propoxyphenyl)methylideneamino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 135598140 |
| Molecular Formula | C20H25ClFN2O2+ |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | [(1R)-1-(2-chloro-6-fluorophenyl)-2-[(2-hydroxy-4-propoxyphenyl)methylideneamino]ethyl]-dimethylazanium |
| SMILES | CCCOc1ccc(/C=N/C[C@@H](c2c(F)cccc2Cl)[NH+](C)C)c(O)c1 |
| InChI | InChI=1S/C20H24ClFN2O2/c1-4-10-26-15-9-8-14(19(25)11-15)12-23-13-18(24(2)3)20-16(21)6-5-7-17(20)22/h5-9,11-12,18,25H,4,10,13H2,1-3H3/p+1/b23-12+/t18-/m0/s1 |
| InChIKey | VXYYCDCWDPKRBQ-KCDOPAPYSA-O |
| XLogP | 3.28 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|