C28H28N4O4S2 — CID 135598874
2-[[11-(4-ethoxyphenyl)-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl]sulfanyl]-N-[(E)-1-(4-hydroxyphenyl)propylideneamino]acetamide (PubChem CID 135598874) has the molecular formula C28H28N4O4S2 and a molecular weight of 548.69 g/mol. Its IUPAC name is 2-[[11-(4-ethoxyphenyl)-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl]sulfanyl]-N-[(E)-1-(4-hydroxyphenyl)propylideneamino]acetamide.
| Compound Name | 2-[[11-(4-ethoxyphenyl)-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl]sulfanyl]-N-[(E)-1-(4-hydroxyphenyl)propylideneamino]acetamide |
|---|---|
| PubChem CID | 135598874 |
| Molecular Formula | C28H28N4O4S2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 2-[[11-(4-ethoxyphenyl)-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl]sulfanyl]-N-[(E)-1-(4-hydroxyphenyl)propylideneamino]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)N/N=C(\CC)c3ccc(O)cc3)nc3sc4c(c3c2=O)CCC4)cc1 |
| InChI | InChI=1S/C28H28N4O4S2/c1-3-22(17-8-12-19(33)13-9-17)30-31-24(34)16-37-28-29-26-25(21-6-5-7-23(21)38-26)27(35)32(28)18-10-14-20(15-11-18)36-4-2/h8-15,33H,3-7,16H2,1-2H3,(H,31,34)/b30-22+ |
| InChIKey | LZOOTUOGLQREER-JBASAIQMSA-N |
| XLogP | 5.06 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|