C27H25ClN4O3S2 — CID 5157972
2-[[3-(4-chlorophenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[1-(4-hydroxyphenyl)propylideneamino]acetamide (PubChem CID 5157972) has the molecular formula C27H25ClN4O3S2 and a molecular weight of 553.11 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[1-(4-hydroxyphenyl)propylideneamino]acetamide.
| Compound Name | 2-[[3-(4-chlorophenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[1-(4-hydroxyphenyl)propylideneamino]acetamide |
|---|---|
| PubChem CID | 5157972 |
| Molecular Formula | C27H25ClN4O3S2 |
| Molecular Weight | 553.11 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[1-(4-hydroxyphenyl)propylideneamino]acetamide |
| SMILES | CCC(=NNC(=O)CSc1nc2sc3c(c2c(=O)n1-c1ccc(Cl)cc1)CCCC3)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H25ClN4O3S2/c1-2-21(16-7-13-19(33)14-8-16)30-31-23(34)15-36-27-29-25-24(20-5-3-4-6-22(20)37-25)26(35)32(27)18-11-9-17(28)10-12-18/h7-14,33H,2-6,15H2,1H3,(H,31,34) |
| InChIKey | ZYPBCTCSEUQFAK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.11 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|