C26H21Cl3N4O2S2 — CID 5157982
2-[[3-(4-chlorophenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[1-(2,4-dichlorophenyl)ethylideneamino]acetamide (PubChem CID 5157982) has the molecular formula C26H21Cl3N4O2S2 and a molecular weight of 591.97 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[1-(2,4-dichlorophenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[3-(4-chlorophenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[1-(2,4-dichlorophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 5157982 |
| Molecular Formula | C26H21Cl3N4O2S2 |
| Molecular Weight | 591.97 g/mol |
| Exact Mass | 590.02 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[1-(2,4-dichlorophenyl)ethylideneamino]acetamide |
| SMILES | CC(=NNC(=O)CSc1nc2sc3c(c2c(=O)n1-c1ccc(Cl)cc1)CCCC3)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H21Cl3N4O2S2/c1-14(18-11-8-16(28)12-20(18)29)31-32-22(34)13-36-26-30-24-23(19-4-2-3-5-21(19)37-24)25(35)33(26)17-9-6-15(27)7-10-17/h6-12H,2-5,13H2,1H3,(H,32,34) |
| InChIKey | CPBUGZMRNSWFMM-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.97 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|