C31H28N4O2S2 — CID 5235616
2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(1-naphthalen-2-ylethylideneamino)acetamide (PubChem CID 5235616) has the molecular formula C31H28N4O2S2 and a molecular weight of 552.73 g/mol. Its IUPAC name is 2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(1-naphthalen-2-ylethylideneamino)acetamide.
| Compound Name | 2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(1-naphthalen-2-ylethylideneamino)acetamide |
|---|---|
| PubChem CID | 5235616 |
| Molecular Formula | C31H28N4O2S2 |
| Molecular Weight | 552.73 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | 2-[[3-(4-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(1-naphthalen-2-ylethylideneamino)acetamide |
| SMILES | CC(=NNC(=O)CSc1nc2sc3c(c2c(=O)n1-c1ccc(C)cc1)CCCC3)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H28N4O2S2/c1-19-11-15-24(16-12-19)35-30(37)28-25-9-5-6-10-26(25)39-29(28)32-31(35)38-18-27(36)34-33-20(2)22-14-13-21-7-3-4-8-23(21)17-22/h3-4,7-8,11-17H,5-6,9-10,18H2,1-2H3,(H,34,36) |
| InChIKey | XXMBQSVPFNTZAN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.73 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|