C26H23FN4O2S2 — CID 5142332
N-[1-(4-fluorophenyl)ethylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 5142332) has the molecular formula C26H23FN4O2S2 and a molecular weight of 506.63 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[1-(4-fluorophenyl)ethylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 5142332 |
| Molecular Formula | C26H23FN4O2S2 |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | CC(=NNC(=O)CSc1nc2sc3c(c2c(=O)n1-c1ccccc1)CCCC3)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H23FN4O2S2/c1-16(17-11-13-18(27)14-12-17)29-30-22(32)15-34-26-28-24-23(20-9-5-6-10-21(20)35-24)25(33)31(26)19-7-3-2-4-8-19/h2-4,7-8,11-14H,5-6,9-10,15H2,1H3,(H,30,32) |
| InChIKey | WJEYYBTXKUYKKT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|