C28H26N4O4S2 — CID 3791353
[4-[C-methyl-N-[[2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]amino]carbonimidoyl]phenyl] acetate (PubChem CID 3791353) has the molecular formula C28H26N4O4S2 and a molecular weight of 546.67 g/mol. Its IUPAC name is [4-[C-methyl-N-[[2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]amino]carbonimidoyl]phenyl] acetate.
| Compound Name | [4-[C-methyl-N-[[2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]amino]carbonimidoyl]phenyl] acetate |
|---|---|
| PubChem CID | 3791353 |
| Molecular Formula | C28H26N4O4S2 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | [4-[C-methyl-N-[[2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]amino]carbonimidoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(C)=NNC(=O)CSc2nc3sc4c(c3c(=O)n2-c2ccccc2)CCCC4)cc1 |
| InChI | InChI=1S/C28H26N4O4S2/c1-17(19-12-14-21(15-13-19)36-18(2)33)30-31-24(34)16-37-28-29-26-25(22-10-6-7-11-23(22)38-26)27(35)32(28)20-8-4-3-5-9-20/h3-5,8-9,12-15H,6-7,10-11,16H2,1-2H3,(H,31,34) |
| InChIKey | RIRCLGGPSLUDAQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|