C14H14ClN5O3S — CID 135599336
methyl (E)-4-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-2-ethanimidoyl-3-hydroxybut-2-enoate (PubChem CID 135599336) has the molecular formula C14H14ClN5O3S and a molecular weight of 367.82 g/mol. Its IUPAC name is methyl (E)-4-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-2-ethanimidoyl-3-hydroxybut-2-enoate.
| Compound Name | methyl (E)-4-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-2-ethanimidoyl-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135599336 |
| Molecular Formula | C14H14ClN5O3S |
| Molecular Weight | 367.82 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | methyl (E)-4-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-2-ethanimidoyl-3-hydroxybut-2-enoate |
| SMILES | [H]/N=C(C)/C(C(=O)OC)=C(\O)CSc1nnnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14ClN5O3S/c1-8(16)12(13(22)23-2)11(21)7-24-14-17-18-19-20(14)10-5-3-9(15)4-6-10/h3-6,16,21H,7H2,1-2H3/b12-11+,16-8+ |
| InChIKey | PYGUVYMPNPJAFH-AXLUTBEVSA-N |
| XLogP | 2.43 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.82 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|