C7H7N3O — CID 135601401
7-methyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 135601401) has the molecular formula C7H7N3O and a molecular weight of 149.15 g/mol. Its IUPAC name is 7-methyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 7-methyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 135601401 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 7-methyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1ccc2c(=O)[nH]cnn12 |
| InChI | InChI=1S/C7H7N3O/c1-5-2-3-6-7(11)8-4-9-10(5)6/h2-4H,1H3,(H,8,9,11) |
| InChIKey | VAYOXAODPYGTEF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |