C12H13N5O2 — CID 135603518
ethyl N-[(Z)-[phenyl(2H-triazol-4-yl)methylidene]amino]carbamate (PubChem CID 135603518) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is ethyl N-[(Z)-[phenyl(2H-triazol-4-yl)methylidene]amino]carbamate.
| Compound Name | ethyl N-[(Z)-[phenyl(2H-triazol-4-yl)methylidene]amino]carbamate |
|---|---|
| PubChem CID | 135603518 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | ethyl N-[(Z)-[phenyl(2H-triazol-4-yl)methylidene]amino]carbamate |
| SMILES | CCOC(=O)N/N=C(/c1ccccc1)c1cn[nH]n1 |
| InChI | InChI=1S/C12H13N5O2/c1-2-19-12(18)16-15-11(10-8-13-17-14-10)9-6-4-3-5-7-9/h3-8H,2H2,1H3,(H,16,18)(H,13,14,17)/b15-11- |
| InChIKey | DWROLULGQOVAPI-PTNGSMBKSA-N |
| XLogP | 1.30 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|