About benzamide;4-methyl-2H-triazole
benzamide;4-methyl-2H-triazole (PubChem CID 175476633) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is benzamide;4-methyl-2H-triazole.
Molecular Properties
| Compound Name | benzamide;4-methyl-2H-triazole |
| PubChem CID | 175476633 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | benzamide;4-methyl-2H-triazole |
| SMILES | Cc1cn[nH]n1.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H7NO.C3H5N3/c8-7(9)6-4-2-1-3-5-6;1-3-2-4-6-5-3/h1-5H,(H2,8,9);2H,1H3,(H,4,5,6) |
| InChIKey | URNVJIRZOYQXSN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzamide;4-methyl-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;4-methyl-2H-triazole?
The IUPAC name of benzamide;4-methyl-2H-triazole (CID 175476633) is benzamide;4-methyl-2H-triazole.
What is the SMILES notation for benzamide;4-methyl-2H-triazole?
The canonical SMILES for benzamide;4-methyl-2H-triazole is Cc1cn[nH]n1.NC(=O)c1ccccc1.
What is the InChIKey of benzamide;4-methyl-2H-triazole?
The InChIKey is URNVJIRZOYQXSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C3H5N3/c8-7(9)6-4-2-1-3-5-6;1-3-2-4-6-5-3/h1-5H,(H2,8,9);2H,1H3,(H,4,5,6).
What are the key properties of benzamide;4-methyl-2H-triazole?
benzamide;4-methyl-2H-triazole has a molecular weight of 204.23 g/mol, XLogP of 0.90, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;4-methyl-2H-triazole is sourced from PubChem (CID 175476633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).