C17H19BrN2O5S — CID 1356047
3-[bis(2-hydroxyethyl)sulfamoyl]-N-(4-bromophenyl)benzamide (PubChem CID 1356047) has the molecular formula C17H19BrN2O5S and a molecular weight of 443.32 g/mol. Its IUPAC name is 3-[bis(2-hydroxyethyl)sulfamoyl]-N-(4-bromophenyl)benzamide.
| Compound Name | 3-[bis(2-hydroxyethyl)sulfamoyl]-N-(4-bromophenyl)benzamide |
|---|---|
| PubChem CID | 1356047 |
| Molecular Formula | C17H19BrN2O5S |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 3-[bis(2-hydroxyethyl)sulfamoyl]-N-(4-bromophenyl)benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1cccc(S(=O)(=O)N(CCO)CCO)c1 |
| InChI | InChI=1S/C17H19BrN2O5S/c18-14-4-6-15(7-5-14)19-17(23)13-2-1-3-16(12-13)26(24,25)20(8-10-21)9-11-22/h1-7,12,21-22H,8-11H2,(H,19,23) |
| InChIKey | BTKGTCKUKOFOJK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |